CAS 1357387-66-6
:4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine
Description:
The chemical substance known as "4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine" with CAS number 1357387-66-6 is a complex organic compound featuring a pyrrolo[2,3-b]pyridine core, which is a bicyclic structure known for its potential biological activity. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its reactivity and interaction with biological targets. Additionally, the incorporation of a dioxaborolane moiety suggests potential applications in boron chemistry, particularly in cross-coupling reactions or as a boron source in various synthetic pathways. The tris(1-methylethyl)silyl group indicates significant steric hindrance, which can affect the compound's stability and reactivity. Overall, this compound's unique structural features may render it valuable in medicinal chemistry and materials science, although specific applications would depend on further research into its properties and behavior in various chemical environments.
Formula:C23H36BF3N2O2Si
InChI:InChI=1S/C23H36BF3N2O2Si/c1-14(2)32(15(3)4,16(5)6)29-12-11-17-19(18(23(25,26)27)13-28-20(17)29)24-30-21(7,8)22(9,10)31-24/h11-16H,1-10H3
InChI key:InChIKey=XUSPWBWOHQXHKS-UHFFFAOYSA-N
SMILES:[Si](C(C)C)(C(C)C)(C(C)C)N1C=2C(C=C1)=C(C(C(F)(F)F)=CN2)B3OC(C)(C)C(C)(C)O3
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)-1-[tris(1-methylethyl)silyl]-
- 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)-1-(triisopropylsilyl)-1h-pyrrolo[2,3-b]pyridine
CAS:Formula:C23H36BF3N2O2SiMolecular weight:468.4358

