CymitQuimica logo

CAS 1357387-81-5

:

2-Bromo-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2-Bromo-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom and a methoxy group, as well as a boron-containing moiety. The presence of the bromine atom suggests potential reactivity in nucleophilic substitution reactions, while the methoxy group can influence the compound's electronic properties and solubility. The tetramethyl-1,3,2-dioxaborolane group introduces boron, which is often utilized in organic synthesis for various applications, including cross-coupling reactions. This compound may exhibit unique properties such as enhanced stability and solubility in organic solvents due to its functional groups. Additionally, the presence of the dioxaborolane moiety can facilitate the formation of organoboron intermediates, making it a valuable building block in synthetic chemistry. Overall, this compound's characteristics make it of interest in both academic research and potential industrial applications.
Formula:C12H17BBrNO3
InChI:InChI=1S/C12H17BBrNO3/c1-11(2)12(3,4)18-13(17-11)8-6-7-15-10(14)9(8)16-5/h6-7H,1-5H3
InChI key:InChIKey=IGZDSVOBSNWDLY-UHFFFAOYSA-N
SMILES:O(C)C=1C(=CC=NC1Br)B2OC(C)(C)C(C)(C)O2
Synonyms:
  • 2-Bromo-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
  • Pyridine, 2-bromo-3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.