CAS 135743-12-3

3-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-4-hydroxy-5-(3-methylbut-2-en-1-yl)benzoic acid

Description:

The chemical substance known as "3-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-4-hydroxy-5-(3-methylbut-2-en-1-yl)benzoic acid," with the CAS number 135743-12-3, is a complex organic compound characterized by its multi-functional structure. It features a benzoic acid core, which is substituted with hydroxy and various alkyl groups, contributing to its potential biological activity. The presence of multiple double bonds in the alkyl side chains indicates that it may exhibit unsaturation, which can influence its reactivity and interactions with other molecules. This compound may be of interest in fields such as medicinal chemistry or natural product synthesis due to its structural complexity and potential pharmacological properties. Additionally, the presence of functional groups such as hydroxyl and carboxylic acid suggests that it could participate in hydrogen bonding and other intermolecular interactions, affecting its solubility and stability in various solvents. Overall, this compound represents a unique structure that may have applications in various chemical and biological contexts.

Formula: C₂₂H₃₀O₃

InChI: InChI=1/C22H30O3/c1-15(2)7-6-8-17(5)10-12-19-14-20(22(24)25)13-18(21(19)23)11-9-16(3)4/h7,9-10,13-14,23H,6,8,11-12H2,1-5H3,(H,24,25)/b17-10+

Synonyms:

• Myrsinoic acid A

3-Geranyl-4-hydroxy-5-prenylbenzoic acid

CAS: 135743-12-3

3-Geranyl-4-hydroxy-5-prenylbenzoic acid is a useful organic compound for research related to life sciences.

Formula: C₂₂H₃₀O₃

Color and Shape: Solid

Molecular weight: 342.479

Ref: TM-T125994

Myrsinoic Acid A

Controlled Product

CAS: 135743-12-3

Formula: C₂₂H₃₀O₃

Color and Shape: Neat

Molecular weight: 342.472

Ref: TR-M885055

Myrsinoic acid A

CAS: 135743-12-3

Myrsinoic acid A is a naturally occurring benzoic acid derivative, which is primarily found in plants of the Myrsinaceae family. This compound is isolated from natural sources, specifically from various Myrsine species, utilizing methods such as solvent extraction and chromatographic purification. Myrsinoic acid A functions by modulating various biological pathways, including anti-inflammatory, antimicrobial, and antioxidant activities. Its mode of action involves the inhibition of pro-inflammatory cytokines and interference with microbial growth processes, making it a compound of interest in pharmacological research.

Formula: C₂₂H₃₀O₃

Purity: Min. 95%

Molecular weight: 342.5 g/mol

Ref: 3D-KFA74312