CAS 135743-28-1
:2-chloro-4-nitrophenyl-beta-D-cello-bioside
Description:
2-Chloro-4-nitrophenyl-beta-D-cello-bioside is a chemical compound characterized by its specific functional groups and structural features. It contains a phenyl ring substituted with both a chlorine atom and a nitro group, which contribute to its reactivity and potential applications in various chemical reactions. The presence of the beta-D-cello-bioside moiety indicates that it is a glycoside, suggesting that it may exhibit biological activity, possibly as a substrate for glycosidases or in other biochemical processes. This compound is likely to be soluble in polar solvents due to the presence of hydroxyl groups associated with the sugar component. Its chlorinated and nitro-substituted aromatic structure may impart unique electronic properties, making it of interest in fields such as medicinal chemistry or materials science. Additionally, the compound's stability, reactivity, and potential toxicity would need to be assessed for safe handling and application in research or industrial contexts. Overall, 2-chloro-4-nitrophenyl-beta-D-cello-bioside represents a complex organic molecule with diverse potential uses.
Formula:C18H24ClNO13
InChI:InChI=1/C18H24ClNO13/c19-7-3-6(20(28)29)1-2-8(7)30-17-15(27)13(25)16(10(5-22)32-17)33-18-14(26)12(24)11(23)9(4-21)31-18/h1-3,9-18,21-27H,4-5H2/t9-,10-,11-,12+,13-,14-,15-,16-,17-,18+/m1/s1
Synonyms:- 2-Chloro-4-nitrophenyl-beta-D-cellobioside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Chloro-4-nitrophenyl β-D-cellobioside
CAS:2-Chloro-4-nitrophenyl β-D-cellobiosidePurity:>98%Color and Shape:SolidMolecular weight:497.84g/mol2-Chloro-4-nitrophenyl b-D-cellobioside
CAS:<p>2-Chloro-4-nitrophenyl b-D-cellobioside (CNPG) is a chromogenic enzyme substrate that is commonly used to detect and measure the activity of β-glucosidases. CNPG is cleaved by the enzyme into the chromogenic product, which can be detected spectrophotometrically. β-glucosidases are important enzymes in the breakdown of cellulose, and CNPG is a widely used substrate for the detection and quantification of these enzymes in various research studies.</p>Purity:Min. 95%Color and Shape:PowderMolecular weight:497.83 g/mol


