CAS 1357476-68-6
:N-[4-Methyl-5-[2-(2,2,2-trifluoro-1,1-dimethylethyl)-4-pyridinyl]-2-thiazolyl]acetamide
Description:
N-[4-Methyl-5-[2-(2,2,2-trifluoro-1,1-dimethylethyl)-4-pyridinyl]-2-thiazolyl]acetamide, identified by its CAS number 1357476-68-6, is a synthetic organic compound characterized by its complex molecular structure, which includes a thiazole ring, a pyridine moiety, and a trifluoromethyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the trifluoromethyl group often enhances lipophilicity and metabolic stability, which can influence the compound's pharmacokinetic properties. Additionally, the thiazole and pyridine components may contribute to its biological activity, potentially interacting with various biological targets. As with many synthetic compounds, the specific characteristics, including melting point, boiling point, and reactivity, would depend on the precise conditions and methods of synthesis. Safety data and handling precautions are essential when working with this compound, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C15H16F3N3OS
InChI:InChI=1S/C15H16F3N3OS/c1-8-12(23-13(20-8)21-9(2)22)10-5-6-19-11(7-10)14(3,4)15(16,17)18/h5-7H,1-4H3,(H,20,21,22)
InChI key:InChIKey=PUQITTZJAFOSAJ-UHFFFAOYSA-N
SMILES:CC1=C(SC(NC(C)=O)=N1)C=2C=C(C(C(F)(F)F)(C)C)N=CC2
Synonyms:- Acetamide, N-[4-methyl-5-[2-(2,2,2-trifluoro-1,1-dimethylethyl)-4-pyridinyl]-2-thiazolyl]-
- N-[4-Methyl-5-[2-(2,2,2-trifluoro-1,1-dimethylethyl)-4-pyridinyl]-2-thiazolyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
