CAS 135748-35-5

4-chloro-2,5-difluorobenzonitrile

Description:

4-Chloro-2,5-difluorobenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chloro group, two fluorine atoms, and a nitrile functional group. The presence of the chloro and difluoro substituents contributes to its unique chemical properties, such as increased reactivity and potential for hydrogen bonding. This compound is typically a solid at room temperature and is known for its relatively high stability under standard conditions. It is often utilized in various chemical synthesis processes, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in electrophilic aromatic substitution reactions. The nitrile group imparts additional polar characteristics, enhancing its solubility in polar solvents. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, 4-chloro-2,5-difluorobenzonitrile is a valuable compound in organic chemistry with specific applications in research and industry.

Formula: C₇H₂ClF₂N

InChI: InChI=1S/C7H2ClF2N/c8-5-2-6(9)4(3-11)1-7(5)10/h1-2H

InChI key: InChIKey=OMVDTUXOHXQKML-UHFFFAOYSA-N

SMILES: C(#N)C1=C(F)C=C(Cl)C(F)=C1

Synonyms:

• Benzonitrile, 4-Chloro-2,5-Difluoro-
• 4-Chloro-2,5-difluorobenzonitrile

Benzonitrile, 4-chloro-2,5-difluoro-

CAS: 135748-35-5

Formula: C₇H₂ClF₂N

Purity: 97%

Color and Shape: Solid

Molecular weight: 173.5473

Ref: IN-DA00HUE5

4-Chloro-2,5-difluorobenzonitrile

CAS: 135748-35-5

4-Chloro-2,5-difluorobenzonitrile

Purity: 97%

Molecular weight: 173.55g/mol

Ref: 54-PC902770

4-Chloro-2,5-difluorobenzonitrile

CAS: 135748-35-5

Formula: C₇H₂ClF₂N

Purity: 97%

Color and Shape: Solid

Molecular weight: 173.55

Ref: 10-F222080