CAS 13575-43-4

Thiazolo[4,5-b]pyridine-2,5-diamine

Description:

Thiazolo[4,5-b]pyridine-2,5-diamine is a heterocyclic organic compound characterized by its fused thiazole and pyridine rings, which contribute to its unique chemical properties. This compound features two amino groups at the 2 and 5 positions of the pyridine ring, enhancing its potential for hydrogen bonding and reactivity. The presence of sulfur in the thiazole ring adds to its electronic properties, making it a candidate for various chemical reactions and applications. Thiazolo[4,5-b]pyridine derivatives are of interest in medicinal chemistry due to their biological activity, including potential antimicrobial and anticancer properties. The compound's structure allows for various modifications, which can lead to the development of new pharmaceuticals. Additionally, its solubility and stability in different solvents can vary, influencing its practical applications in research and industry. Overall, Thiazolo[4,5-b]pyridine-2,5-diamine represents a versatile scaffold in organic synthesis and drug development.

Formula: C₆H₆N₄S

InChI: InChI=1S/C6H6N4S/c7-4-2-1-3-5(9-4)10-6(8)11-3/h1-2H,(H4,7,8,9,10)

InChI key: InChIKey=OUQVIBJBPCRCAT-UHFFFAOYSA-N

SMILES: NC=1SC=2C(N1)=NC(N)=CC2

Synonyms:

• Thiazolo[4,5-b]pyridine-2,5-diamine
• [1,3]Thiazolo[4,5-b]pyridine-2,5-diamine
• Thiazolo[4,5-b]pyridine, 2,5-diamino-

[1,3]Thiazolo[4,5-b]pyridine-2,5-diamine

CAS: 13575-43-4

Versatile small molecule scaffold

Formula: C₆H₆N₄S

Purity: Min. 95%

Molecular weight: 166.21 g/mol

Ref: 3D-NAA57543