CAS 13575-47-8

Carbamodithioic acid, dimethyl-, 1-piperidinylmethyl ester

Description:

Carbamodithioic acid, dimethyl-, 1-piperidinylmethyl ester, with the CAS number 13575-47-8, is an organic compound characterized by its functional groups, including a carbamodithioic acid moiety and a piperidinylmethyl ester structure. This compound typically exhibits properties associated with both thioamide and ester functionalities, which may influence its reactivity and solubility in various solvents. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the piperidine ring suggests potential basicity and the ability to participate in nucleophilic reactions. Additionally, the dimethyl groups contribute to steric hindrance, which can affect the compound's reactivity and interaction with biological systems. This compound may have applications in organic synthesis or as an intermediate in the production of other chemical entities. However, specific safety and handling guidelines should be followed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₉H₁₈N₂S₂

InChI: InChI=1S/C9H18N2S2/c1-10(2)9(12)13-8-11-6-4-3-5-7-11/h3-8H2,1-2H3

InChI key: InChIKey=ISLFJOPPIKIHHW-UHFFFAOYSA-N

SMILES: C(SC(N(C)C)=S)N1CCCCC1

Synonyms:

• Carbamodithioic acid, dimethyl-, 1-piperidinylmethyl ester
• NSC 161540
• 1-Piperidinemethanethiol, dimethyldithiocarbamate (ester)
• Carbamic acid, dimethyldithio-, piperidinomethyl ester

Carbamodithioic acid, dimethyl-, 1-piperidinylmethyl ester

CAS: 13575-47-8

Formula: C₉H₁₈N₂S₂

Molecular weight: 218.3826

Ref: IN-DA01X4WE