CAS 13575-72-9
:2-Aminoindan-1-ol
Description:
2-Aminoindan-1-ol is an organic compound characterized by its bicyclic structure, which consists of an indane framework with an amino group and a hydroxyl group attached to the first carbon of the indane ring. This compound is typically a white to off-white solid at room temperature and is soluble in polar solvents due to the presence of the hydroxyl group. It exhibits basic properties due to the amino group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. 2-Aminoindan-1-ol has been studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may exhibit biological activity related to neurotransmitter modulation. Its structural features contribute to its ability to interact with biological targets, making it of interest in research related to neuropharmacology and other therapeutic areas. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C9H11NO
InChI:InChI=1/C9H11NO/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8-9,11H,5,10H2
SMILES:c1ccc2c(c1)CC(C2O)N
Synonyms:- 2-Amino-1-hydroxyindane
- 2-amino-2,3-dihydro-1H-inden-1-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Amino-1-hydroxyindane
CAS:2-Amino-1-hydroxyindaneFormula:C9H11NOPurity:≥95%Color and Shape: off-white to beige crystalline solidMolecular weight:149.19g/mol2-Aminoindan-1-ol
CAS:2-Aminoindan-1-ol is an enantiomer of 2-aminoindane. It is a chiral, yields, lactams, antagonist, stereoselective, reacts efficiently with the most reactive electrophiles and has been shown to be an efficient method for generating β-unsaturated and bicyclic alcohols. The chemical reactions of 2-aminoindan-1-ol are thought to involve the formation of an intermediate carbocation that undergoes nucleophilic attack by the electrophile. 2-Aminoindan-1-ol has been shown to inhibit dopaminergic activity in vitro and in vivo.
Formula:C9H11NOPurity:Min. 95%Molecular weight:149.19 g/molRef: 3D-NAA57572
Discontinued product

