CAS 135754-92-6
:(2E,4E)-5-(4-Hydroxyphenyl)-2,4-pentadienoic acid
Description:
(2E,4E)-5-(4-Hydroxyphenyl)-2,4-pentadienoic acid, also known as a derivative of phenolic compounds, exhibits several notable characteristics. This compound features a conjugated diene system, which contributes to its reactivity and potential biological activity. The presence of the 4-hydroxyphenyl group enhances its solubility in polar solvents and may influence its interaction with biological targets, such as enzymes or receptors. The compound is likely to exhibit antioxidant properties due to the hydroxyl group, which can donate hydrogen atoms to free radicals. Additionally, its structural configuration, indicated by the (2E,4E) notation, suggests specific geometric isomerism that can affect its stability and reactivity. The molecular structure may also allow for various functional group interactions, making it of interest in medicinal chemistry and materials science. Overall, this compound's unique features position it as a subject of interest for further research in pharmacology and organic synthesis.
Formula:C11H10O3
InChI:InChI=1S/C11H10O3/c12-10-7-5-9(6-8-10)3-1-2-4-11(13)14/h1-8,12H,(H,13,14)/b3-1+,4-2+
InChI key:InChIKey=CYYTUYSFBHDJRH-ZPUQHVIOSA-N
SMILES:C(=C/C=C/C(O)=O)\C1=CC=C(O)C=C1
Synonyms:- Avenalumic acid
- 2,4-Pentadienoic acid, 5-(4-hydroxyphenyl)-, (2E,4E)-
- 2,4-Pentadienoic acid, 5-(4-hydroxyphenyl)-, (E,E)-
- (2E,4E)-5-(4-Hydroxyphenyl)-2,4-pentadienoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Avenalumic acid
CAS:Avenalumic acid is a biochemical.Formula:C11H10O3Color and Shape:SolidMolecular weight:190.2


