CymitQuimica logo

CAS 13576-52-8

:

4-(2-Amino-5-oxazolyl)phenol

Description:
4-(2-Amino-5-oxazolyl)phenol, with the CAS number 13576-52-8, is an organic compound characterized by its phenolic structure, which includes an amino group and an oxazole ring. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of the amino group contributes to its basicity and reactivity, while the oxazole ring can impart unique electronic properties. The phenolic hydroxyl group can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C9H8N2O2
InChI:InChI=1S/C9H8N2O2/c10-9-11-5-8(13-9)6-1-3-7(12)4-2-6/h1-5,12H,(H2,10,11)
InChI key:InChIKey=BQVVQNKRIUCRNE-UHFFFAOYSA-N
SMILES:NC=1OC(C2=CC=C(O)C=C2)=CN1
Synonyms:
  • Phenol, 4-(2-amino-5-oxazolyl)-
  • 4-(2-Amino-5-oxazolyl)phenol
  • Phenol, p-(2-amino-5-oxazolyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.