
CAS 13576-53-9
:5-[4-(Methylsulfonyl)phenyl]-2-oxazolamine
Description:
5-[4-(Methylsulfonyl)phenyl]-2-oxazolamine, with the CAS number 13576-53-9, is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a methylsulfonyl group attached to a phenyl ring, contributing to its unique chemical properties. The presence of the oxazolamine moiety suggests potential applications in medicinal chemistry, particularly as a scaffold for drug development. The methylsulfonyl group enhances solubility and may influence the compound's biological activity. Additionally, the compound's structure indicates potential interactions with biological targets, making it of interest in pharmacological studies. Its stability, reactivity, and solubility in various solvents can vary based on environmental conditions, which are important considerations for its practical applications. Overall, 5-[4-(Methylsulfonyl)phenyl]-2-oxazolamine represents a versatile compound with potential utility in various chemical and pharmaceutical contexts.
Formula:C10H10N2O3S
InChI:InChI=1S/C10H10N2O3S/c1-16(13,14)8-4-2-7(3-5-8)9-6-12-10(11)15-9/h2-6H,1H3,(H2,11,12)
InChI key:InChIKey=UVPQDKLMXBCSGA-UHFFFAOYSA-N
SMILES:NC=1OC(C2=CC=C(S(C)(=O)=O)C=C2)=CN1
Synonyms:- 5-[4-(Methylsulfonyl)phenyl]-2-oxazolamine
- Oxazole, 2-amino-5-[p-(methylsulfonyl)phenyl]-
- 2-Oxazolamine, 5-[4-(methylsulfonyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.