
CAS 13576-58-4
:5-(4-Aminophenyl)-2-oxazolamine
Description:
5-(4-Aminophenyl)-2-oxazolamine, with the CAS number 13576-58-4, is an organic compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features an amino group attached to a phenyl ring, contributing to its potential as a pharmaceutical intermediate or in various chemical syntheses. The presence of the amino group suggests that it may exhibit basic properties and can participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the oxazolamine moiety may impart specific biological activities, making it of interest in medicinal chemistry. The compound's stability, melting point, and solubility characteristics would depend on its molecular interactions and the presence of functional groups. Overall, 5-(4-Aminophenyl)-2-oxazolamine is a compound of interest in research and development, particularly in the fields of organic synthesis and drug discovery.
Formula:C9H9N3O
InChI:InChI=1S/C9H9N3O/c10-7-3-1-6(2-4-7)8-5-12-9(11)13-8/h1-5H,10H2,(H2,11,12)
InChI key:InChIKey=DMVAESBOBZKXOO-UHFFFAOYSA-N
SMILES:NC=1OC(C2=CC=C(N)C=C2)=CN1
Synonyms:- 5-(4-Aminophenyl)-2-oxazolamine
- 2-Oxazolamine, 5-(4-aminophenyl)-
- Oxazole, 2-amino-5-(p-aminophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.