CAS 13576-85-7

1-[2-(4-methoxyphenyl)ethyl]urea

Description:

1-[2-(4-methoxyphenyl)ethyl]urea, with the CAS number 13576-85-7, is an organic compound characterized by its urea functional group and a substituted ethyl group. This compound features a methoxyphenyl moiety, which contributes to its aromatic properties and potential biological activity. Typically, urea derivatives exhibit a range of pharmacological effects, and this particular compound may be investigated for its interactions in biological systems. The presence of the methoxy group enhances its lipophilicity, potentially influencing its solubility and permeability in biological membranes. In terms of physical properties, it is likely to be a solid at room temperature, with moderate melting and boiling points typical of similar organic compounds. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific reactivity and stability characteristics would depend on the conditions under which it is handled and the presence of other functional groups in a given reaction environment. As with all chemical substances, safety data and handling precautions should be consulted before use.

Formula: C₁₀H₁₄N₂O₂

InChI: InChI=1/C10H14N2O2/c1-14-9-4-2-8(3-5-9)6-7-12-10(11)13/h2-5H,6-7H2,1H3,(H3,11,12,13)

SMILES: COc1ccc(cc1)CCNC(=N)O

Synonyms:

• [2-(4-Methoxyphenyl)Ethyl]Urea

[2-(4-Methoxyphenyl)ethyl]urea

CAS: 13576-85-7

Versatile small molecule scaffold

Formula: C₁₀H₁₄N₂O₂

Purity: Min. 95%

Molecular weight: 194.23 g/mol

Ref: 3D-NAA57685