CAS 13577-40-7
:1-(5,6,7,8-TETRAHYDRO-NAPHTHALEN-1-YL)-ETHANONE
Description:
1-(5,6,7,8-Tetrahydro-naphthalen-1-yl)-ethanone, with the CAS number 13577-40-7, is an organic compound characterized by its ketone functional group and a tetrahydronaphthalene moiety. This compound features a bicyclic structure, which contributes to its unique physical and chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the ketone group suggests that it may exhibit reactivity typical of carbonyl compounds, such as nucleophilic addition reactions. Additionally, the tetrahydronaphthalene structure may impart hydrophobic characteristics, influencing its solubility in organic solvents while being less soluble in water. This compound may be of interest in various applications, including organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H14O
InChI:InChI=1/C12H14O/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11/h4,6,8H,2-3,5,7H2,1H3
SMILES:CC(=O)c1cccc2CCCCc12
Synonyms:- 1-(5,6,7,8-Tetrahydro-naphthalen-1-
- Yl)-Ethanone
- 1-(5,6,7,8-Tetrahydronaphthalen-1-yl)ethanone
- Ethanone, 1-(5,6,7,8-Tetrahydro-1-Naphthalenyl)-
- 1-Tetralin-5-Ylethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
