CAS 135778-76-6

2,6-Dimethyl-1-propylpiperazine

Description:

2,6-Dimethyl-1-propylpiperazine is a chemical compound characterized by its piperazine backbone, which consists of a six-membered ring containing two nitrogen atoms. The presence of two methyl groups at the 2 and 6 positions, along with a propyl group at the 1 position, contributes to its unique structural and chemical properties. This compound is typically a colorless to pale yellow liquid and is soluble in organic solvents. It exhibits basic properties due to the nitrogen atoms in the piperazine ring, allowing it to participate in various chemical reactions, including alkylation and acylation. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 2,6-Dimethyl-1-propylpiperazine is a versatile compound with potential applications in both industrial and research settings.

Formula: C₉H₂₀N₂

InChI: InChI=1S/C9H20N2/c1-4-5-11-8(2)6-10-7-9(11)3/h8-10H,4-7H2,1-3H3

InChI key: InChIKey=TYTITCUEUIIXNP-UHFFFAOYSA-N

SMILES: C(CC)N1C(C)CNCC1C

Synonyms:

• 2,6-Dimethyl-1-propylpiperazine
• Piperazine, 2,6-dimethyl-1-propyl-