CAS 135782-19-3

2-Morpholinecarboxylicacid,methylester(9CI)

Description:

2-Morpholinecarboxylic acid, methyl ester, also known by its CAS number 135782-19-3, is an organic compound characterized by the presence of a morpholine ring and a carboxylic acid functional group esterified with a methyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar solvents such as water and alcohols, which is indicative of its polar functional groups. The presence of the morpholine moiety contributes to its potential as a building block in pharmaceuticals and agrochemicals due to its ability to form hydrogen bonds and interact with biological systems. Additionally, 2-Morpholinecarboxylic acid, methyl ester may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during use. Its chemical properties, such as reactivity and stability, make it a valuable intermediate in organic synthesis, particularly in the development of various chemical products.

Formula: C₆H₁₁NO₃

InChI: InChI=1/C6H11NO3/c1-9-6(8)5-4-7-2-3-10-5/h5,7H,2-4H2,1H3

SMILES: COC(=O)C1CNCCO1

Synonyms:

• Methyl Morpholine-2-Carboxylate
• 2-Morpholinecarboxylic acid, methyl ester

Methyl morpholine-2-carboxylate

CAS: 135782-19-3

Formula: C₆H₁₁NO₃

Purity: 95%

Color and Shape: Liquid

Molecular weight: 145.1564

Ref: IN-DA007N6H

Methyl morpholine-2-carboxylate

CAS: 135782-19-3

Methyl morpholine-2-carboxylate

Formula: C₆H₁₁NO₃

Purity: 95%

Color and Shape: white powder

Molecular weight: 145.16g/mol

Ref: 54-OR907633