CAS 135782-20-6
:4-CBZ-2-HYDROXYMETHYLMORPHOLINE
Description:
4-CBZ-2-Hydroxymethylmorpholine, identified by its CAS number 135782-20-6, is a chemical compound characterized by its morpholine structure, which includes a hydroxymethyl group and a carbobenzyloxy (CBZ) protecting group. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. Its molecular structure features a morpholine ring, which contributes to its potential applications in medicinal chemistry, particularly in the synthesis of pharmaceuticals. The presence of the hydroxymethyl group can enhance reactivity, making it useful in various chemical reactions, including those involving nucleophilic substitutions. The CBZ group serves as a protective group for amines, facilitating the selective functionalization of other reactive sites in synthetic pathways. Overall, 4-CBZ-2-Hydroxymethylmorpholine is valued for its versatility in organic synthesis and its role in the development of biologically active compounds. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C13H17NO4
InChI:InChI=1/C13H17NO4/c15-9-12-8-14(6-7-17-12)13(16)18-10-11-4-2-1-3-5-11/h1-5,12,15H,6-10H2
SMILES:c1ccc(cc1)COC(=O)N1CCOC(C1)CO
Synonyms:- Benzyl 2-(Hydroxymethyl)Morpholine-4-Carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.