CAS 135782-73-9

8-Chloro-3-(2,4-dichlorophenyl)-6-(trifluoromethyl)-1,2,4-triazolo[4,3-a]pyridine

Description:

8-Chloro-3-(2,4-dichlorophenyl)-6-(trifluoromethyl)-1,2,4-triazolo[4,3-a]pyridine is a heterocyclic compound characterized by its complex structure, which includes a triazole ring fused to a pyridine moiety. This compound features multiple halogen substituents, specifically chlorine and trifluoromethyl groups, which significantly influence its chemical reactivity and biological activity. The presence of the 2,4-dichlorophenyl group enhances its lipophilicity, potentially affecting its pharmacokinetic properties. The triazole ring contributes to its stability and can participate in hydrogen bonding, making it a candidate for various applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's unique combination of functional groups may impart specific biological activities, including antimicrobial or antifungal properties, although detailed studies would be necessary to elucidate its full biological profile. Overall, this compound exemplifies the intricate interplay of structure and function in organic chemistry, particularly in the context of drug design and development.

Formula: C₁₃H₅Cl₃F₃N₃

InChI: InChI=1S/C13H5Cl3F3N3/c14-7-1-2-8(9(15)4-7)11-20-21-12-10(16)3-6(5-22(11)12)13(17,18)19/h1-5H

InChI key: InChIKey=FZECSGOVEUPZFI-UHFFFAOYSA-N

SMILES: ClC=1C=2N(C(=NN2)C3=C(Cl)C=C(Cl)C=C3)C=C(C(F)(F)F)C1

Synonyms:

• 8-Chloro-3-(2,4-dichlorophenyl)-6-(trifluoromethyl)-1,2,4-triazolo[4,3-a]pyridine
• 1,2,4-Triazolo[4,3-a]pyridine, 8-chloro-3-(2,4-dichlorophenyl)-6-(trifluoromethyl)-