CAS 135788-09-9

2H-Tetrazolium, 2,3-bis(4-fluorophenyl)-5-phenyl-, chloride (1:1)

Description:

2H-Tetrazolium, 2,3-bis(4-fluorophenyl)-5-phenyl-, chloride (1:1), with CAS number 135788-09-9, is a chemical compound characterized by its tetrazolium structure, which is a five-membered ring containing four nitrogen atoms and one carbon atom. This compound features two 4-fluorophenyl groups and a phenyl group, contributing to its aromatic character and potential for various chemical interactions. The presence of the chloride ion indicates that it is a salt, which may influence its solubility and reactivity in different solvents. Tetrazolium salts are often used in biological assays, particularly in cell viability and proliferation studies, due to their ability to be reduced by living cells to form formazan dyes, which can be quantified spectrophotometrically. The fluorine substituents may enhance the compound's electronic properties, potentially affecting its reactivity and interactions with biological systems. Overall, this compound's unique structure and properties make it of interest in both synthetic chemistry and biological applications.

Formula: C₁₉H₁₃F₂N₄·Cl

InChI: InChI=1S/C19H13F2N4.ClH/c20-15-6-10-17(11-7-15)24-22-19(14-4-2-1-3-5-14)23-25(24)18-12-8-16(21)9-13-18;/h1-13H;1H/q+1;/p-1

InChI key: InChIKey=IMDGDYWQWVOCFG-UHFFFAOYSA-M

SMILES: FC1=CC=C(N2[N+](=NC(=N2)C3=CC=CC=C3)C4=CC=C(F)C=C4)C=C1.[Cl-]

Synonyms:

• 2H-Tetrazolium, 2,3-bis(4-fluorophenyl)-5-phenyl-, chloride (1:1)
• 2H-Tetrazolium, 2,3-bis(4-fluorophenyl)-5-phenyl-, chloride

2,3-Bis(4-fluorophenyl)-5-phenyltetrazolium chloride

CAS: 135788-09-9

2,3-Bis(4-fluorophenyl)-5-phenyltetrazolium chloride

Purity: ≥95%

Molecular weight: 370.78g/mol

Ref: 54-PC7618