CAS 1357945-32-4

Isoquinoline, 3-(bromomethyl)-, hydrobromide (1:1)

Description:

Isoquinoline, 3-(bromomethyl)-, hydrobromide (1:1) is a chemical compound characterized by its isoquinoline backbone, which is a bicyclic structure consisting of a benzene ring fused to a pyridine ring. The presence of a bromomethyl group at the 3-position of the isoquinoline structure introduces a reactive site, making it useful in various chemical reactions, particularly in the synthesis of more complex organic molecules. As a hydrobromide salt, it is typically encountered in a solid form and is soluble in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and the presence of other functional groups. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental hazards. Overall, this compound serves as a valuable intermediate in organic synthesis and research applications.

Formula: C₁₀H₈BrN·BrH

InChI: InChI=1S/C10H8BrN.BrH/c11-6-10-5-8-3-1-2-4-9(8)7-12-10;/h1-5,7H,6H2;1H

InChI key: InChIKey=PZJYIMPJBSNXFJ-UHFFFAOYSA-N

SMILES: C(Br)C1=CC2=C(C=N1)C=CC=C2.Br

Synonyms:

• Isoquinoline, 3-(bromomethyl)-, hydrobromide (1:1)