CAS 1357945-39-1

3-Bromo-5-methoxy-1H-pyrazolo[3,4-c]pyridine

Description:

3-Bromo-5-methoxy-1H-pyrazolo[3,4-c]pyridine is a heterocyclic organic compound characterized by its pyrazolo-pyridine structure, which consists of a fused pyrazole and pyridine ring system. The presence of a bromine atom at the 3-position and a methoxy group at the 5-position contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is of interest in medicinal chemistry due to its potential biological activities, which may include anti-inflammatory or neuroprotective effects. The bromine substituent can enhance the compound's reactivity, making it a useful intermediate in various synthetic pathways. Additionally, the methoxy group can influence the electronic properties of the molecule, affecting its interaction with biological targets. As with many heterocycles, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Proper handling and storage are essential due to potential hazards associated with brominated compounds.

Formula: C₇H₆BrN₃O

InChI: InChI=1S/C7H6BrN3O/c1-12-6-2-4-5(3-9-6)10-11-7(4)8/h2-3H,1H3,(H,10,11)

InChI key: InChIKey=IVAIJSPCHCHDKO-UHFFFAOYSA-N

SMILES: BrC=1C=2C(=CN=C(OC)C2)NN1

Synonyms:

• 1H-Pyrazolo[3,4-c]pyridine, 3-bromo-5-methoxy-
• 3-Bromo-5-methoxy-1H-pyrazolo[3,4-c]pyridine

3-BROMO-5-METHOXY-1H-PYRAZOLO[3,4-C]PYRIDINE

CAS: 1357945-39-1

Formula: C₇H₆BrN₃O

Purity: 95.0%

Molecular weight: 228.049

Ref: 10-F471864