CAS 1357945-76-6
:3,4-Dibromo-1H-pyrazolo[3,4-c]pyridine
Description:
3,4-Dibromo-1H-pyrazolo[3,4-c]pyridine is a heterocyclic organic compound characterized by its pyrazolo and pyridine ring structures, which contribute to its unique chemical properties. This compound features two bromine atoms substituted at the 3 and 4 positions of the pyrazolo ring, enhancing its reactivity and potential applications in various fields, including medicinal chemistry and material science. The presence of bromine atoms can influence the compound's electronic properties, making it a candidate for further functionalization or as a building block in the synthesis of more complex molecules. Additionally, the fused ring system provides stability and can affect the compound's solubility and interaction with biological targets. Its structural characteristics may also impart specific biological activities, making it of interest in drug discovery. As with many brominated compounds, considerations regarding environmental impact and toxicity are essential in its handling and application. Overall, 3,4-Dibromo-1H-pyrazolo[3,4-c]pyridine represents a versatile compound with potential utility in various chemical and pharmaceutical contexts.
Formula:C6H3Br2N3
InChI:InChI=1S/C6H3Br2N3/c7-3-1-9-2-4-5(3)6(8)11-10-4/h1-2H,(H,10,11)
InChI key:InChIKey=KURIEZBDQSXVCJ-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CN=C1)NN=C2Br
Synonyms:- 3,4-Dibromo-1H-pyrazolo[3,4-c]pyridine
- 1H-Pyrazolo[3,4-c]pyridine, 3,4-dibromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.