CAS 1357945-88-0

Pyridine, 5-(chloromethyl)-2-(1-methylethoxy)-, hydrochloride (1:1)

Description:

Pyridine, 5-(chloromethyl)-2-(1-methylethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloromethyl group and an ethoxy substituent, contributing to its reactivity and potential applications in organic synthesis. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in polar solvents, particularly water. The presence of the chloromethyl group suggests potential for nucleophilic substitution reactions, making it useful in the synthesis of various organic compounds. Additionally, the ethoxy group may influence the compound's solubility and interaction with biological systems. Pyridine derivatives are often studied for their roles in pharmaceuticals, agrochemicals, and as intermediates in chemical synthesis. Safety data should be consulted, as pyridine derivatives can exhibit toxicity and environmental hazards. Overall, this compound's unique structure and functional groups make it a subject of interest in both academic and industrial chemistry.

Formula: C₉H₁₂ClNO·ClH

InChI: InChI=1S/C9H12ClNO.ClH/c1-7(2)12-9-4-3-8(5-10)6-11-9;/h3-4,6-7H,5H2,1-2H3;1H

InChI key: InChIKey=PLRZLPCQYALLGQ-UHFFFAOYSA-N

SMILES: O(C(C)C)C1=CC=C(CCl)C=N1.Cl

Synonyms:

• Pyridine, 5-(chloromethyl)-2-(1-methylethoxy)-, hydrochloride (1:1)