CAS 1357946-03-2

4-Methoxy-1H-pyrazolo[4,3-c]pyridine

Description:

4-Methoxy-1H-pyrazolo[4,3-c]pyridine is a heterocyclic organic compound characterized by its unique pyrazolo-pyridine structure, which consists of a pyrazole ring fused to a pyridine ring. This compound features a methoxy group (-OCH3) at the 4-position of the pyrazole ring, which can influence its chemical reactivity and solubility. Typically, compounds of this class exhibit interesting biological activities, making them of interest in medicinal chemistry and drug development. The presence of the methoxy group can enhance lipophilicity and potentially improve the compound's pharmacokinetic properties. Additionally, the fused ring system contributes to the compound's stability and may affect its electronic properties, making it a candidate for various applications, including as a scaffold for designing new pharmaceuticals. Its specific interactions with biological targets can vary, and further studies are often required to elucidate its mechanisms of action and potential therapeutic uses.

Formula: C₇H₇N₃O

InChI: InChI=1S/C7H7N3O/c1-11-7-5-4-9-10-6(5)2-3-8-7/h2-4H,1H3,(H,9,10)

InChI key: InChIKey=BSIQPAUVVYGOSD-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(NN=C2)=CC=N1

Synonyms:

• 4-Methoxy-1H-pyrazolo[4,3-c]pyridine
• 1H-Pyrazolo[4,3-c]pyridine, 4-methoxy-

4-Methoxy-1H-pyrazolo[4,3-c]pyridine

CAS: 1357946-03-2

Please enquire for more information about 4-Methoxy-1H-pyrazolo[4,3-c]pyridine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₇H₇N₃O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 149.15 g/mol

Ref: 3D-HEC94603

4-METHOXY-1H-PYRAZOLO[4,3-C]PYRIDINE

CAS: 1357946-03-2

Formula: C₇H₇N₃O

Purity: 95.0%

Molecular weight: 149.153

Ref: 10-F471862