
CAS 1357946-08-7
:8-Bromoimidazo[1,2-a]pyridin-5-amine
Description:
8-Bromoimidazo[1,2-a]pyridin-5-amine is a heterocyclic organic compound characterized by the presence of both bromine and an imidazo-pyridine structure. This compound features a bromine atom at the 8-position of the imidazo ring and an amino group at the 5-position of the pyridine moiety. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the bromine atom can enhance the compound's reactivity and influence its interactions with biological targets. Additionally, the imidazo and pyridine rings provide a framework that can facilitate various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound is typically characterized by its solubility in organic solvents and may exhibit specific spectral properties in techniques such as NMR and mass spectrometry. Overall, 8-Bromoimidazo[1,2-a]pyridin-5-amine is a valuable compound for research in drug discovery and development due to its unique structural features and potential applications.
Formula:C7H6BrN3
InChI:InChI=1S/C7H6BrN3/c8-5-1-2-6(9)11-4-3-10-7(5)11/h1-4H,9H2
InChI key:InChIKey=RONUBAJOCKJQGX-UHFFFAOYSA-N
SMILES:BrC=1C=2N(C(N)=CC1)C=CN2
Synonyms:- Imidazo[1,2-a]pyridin-5-amine, 8-bromo-
- 8-Bromoimidazo[1,2-a]pyridin-5-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.