CAS 1357946-36-1

Pyridine, 4-(chloromethyl)-2-(1-methylethoxy)-, hydrochloride (1:1)

Description:

Pyridine, 4-(chloromethyl)-2-(1-methylethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloromethyl group and an ethoxy substituent, contributing to its reactivity and potential applications in organic synthesis. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various chemical processes. The presence of the chloromethyl group suggests potential for nucleophilic substitution reactions, making it a valuable intermediate in the synthesis of more complex organic molecules. Additionally, the ethoxy group may influence the compound's polarity and solubility, affecting its behavior in different solvents. Safety data should be consulted, as compounds containing halogens and nitrogen can exhibit toxicity and environmental hazards. Overall, this compound's unique structure and functional groups position it as an interesting subject for further research in medicinal chemistry and synthetic organic chemistry.

Formula: C₉H₁₂ClNO·ClH

InChI: InChI=1S/C9H12ClNO.ClH/c1-7(2)12-9-5-8(6-10)3-4-11-9;/h3-5,7H,6H2,1-2H3;1H

InChI key: InChIKey=VLHDBMAILUWRIA-UHFFFAOYSA-N

SMILES: O(C(C)C)C1=CC(CCl)=CC=N1.Cl

Synonyms:

• Pyridine, 4-(chloromethyl)-2-(1-methylethoxy)-, hydrochloride (1:1)

4-(Chloromethyl)-2-isopropoxypyridine hcl

CAS: 1357946-36-1

Formula: C₉H₁₃Cl₂NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 222.1116

Ref: IN-DA00AART

4-(Chloromethyl)-2-isopropoxypyridine hydrochloride

CAS: 1357946-36-1

4-(Chloromethyl)-2-isopropoxypyridine hydrochloride

Purity: 95%

Molecular weight: 222.11g/mol

Ref: 54-OR1049969