CAS 1357946-47-4

5-(Trifluoromethyl)-1-isoquinolinamine

Description:

5-(Trifluoromethyl)-1-isoquinolinamine is a chemical compound characterized by its isoquinoline structure, which features a nitrogen atom within a bicyclic aromatic system. The presence of a trifluoromethyl group (-CF3) at the 5-position significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The trifluoromethyl group is known for its electron-withdrawing properties, which can impact the reactivity of the compound in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the amine functional group (-NH2) can participate in hydrogen bonding, influencing the compound's interactions with other molecules. Due to its unique structure, 5-(Trifluoromethyl)-1-isoquinolinamine may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. However, detailed studies on its toxicity, stability, and specific applications would be necessary for a comprehensive understanding of its potential uses.

Formula: C₁₀H₇F₃N₂

InChI: InChI=1S/C10H7F3N2/c11-10(12,13)8-3-1-2-7-6(8)4-5-15-9(7)14/h1-5H,(H2,14,15)

InChI key: InChIKey=UTKTXMZGEXMMBQ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C2=C(C(N)=NC=C2)C=CC1

Synonyms:

• 1-Isoquinolinamine, 5-(trifluoromethyl)-
• 5-(Trifluoromethyl)-1-isoquinolinamine