CAS 1357946-82-7

3-Bromo-7-methoxy-1H-pyrazolo[3,4-c]pyridine

Description:

3-Bromo-7-methoxy-1H-pyrazolo[3,4-c]pyridine is a heterocyclic compound characterized by its unique pyrazolo-pyridine structure, which incorporates both a bromine atom and a methoxy group. The presence of the bromine substituent typically enhances the compound's reactivity, making it useful in various synthetic applications. The methoxy group contributes to the compound's solubility and can influence its electronic properties, potentially affecting its biological activity. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and anticancer activities. Its structure allows for various modifications, which can lead to the development of derivatives with enhanced efficacy or selectivity. The compound's molecular framework also suggests potential interactions with biological targets, making it a candidate for further research in drug development. As with many heterocycles, the stability and reactivity of 3-Bromo-7-methoxy-1H-pyrazolo[3,4-c]pyridine can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings.

Formula: C₇H₆BrN₃O

InChI: InChI=1S/C7H6BrN3O/c1-12-7-5-4(2-3-9-7)6(8)11-10-5/h2-3H,1H3,(H,10,11)

InChI key: InChIKey=ADZICYHPTJSUGX-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(C(Br)=NN2)=CC=N1

Synonyms:

• 1H-Pyrazolo[3,4-c]pyridine, 3-bromo-7-methoxy-
• 3-Bromo-7-methoxy-1H-pyrazolo[3,4-c]pyridine
• 3-Bromo-7-methoxy-2H-pyrazolo[3,4-c]pyridine
• 3-broMo-7-Methoxy-1H-pyrazolo[3