CymitQuimica logo

CAS 1357947-00-2

:

5-Bromoimidazo[1,2-a]pyridin-8-amine

Description:
5-Bromoimidazo[1,2-a]pyridin-8-amine is a heterocyclic organic compound characterized by the presence of both bromine and an imidazole ring fused to a pyridine structure. This compound features a bromine atom at the 5-position of the imidazole ring and an amino group at the 8-position of the pyridine moiety. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the bromine atom can enhance lipophilicity and influence the compound's reactivity, while the amino group may participate in hydrogen bonding and interactions with biological targets. This compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents. Its unique structural features suggest potential applications in the development of pharmaceuticals, particularly in targeting specific biological pathways or receptors. As with many heterocycles, it may also serve as a building block for further chemical modifications in synthetic chemistry.
Formula:C7H6BrN3
InChI:InChI=1S/C7H6BrN3/c8-6-2-1-5(9)7-10-3-4-11(6)7/h1-4H,9H2
InChI key:InChIKey=RIRVIHIWGWHGQX-UHFFFAOYSA-N
SMILES:NC=1C=2N(C(Br)=CC1)C=CN2
Synonyms:
  • Imidazo[1,2-a]pyridin-8-amine, 5-bromo-
  • 5-Bromoimidazo[1,2-a]pyridin-8-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.