CAS 135795-46-9

3-AMINO-2-BROMO-6-METHOXYPYRIDINE

Description:

3-Amino-2-bromo-6-methoxypyridine is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2, 3, and 6 positions. The presence of an amino group (-NH2) at the 3-position contributes to its basicity and potential reactivity in various chemical reactions, while the bromo group (-Br) at the 2-position introduces electrophilic characteristics, making it a useful intermediate in organic synthesis. The methoxy group (-OCH3) at the 6-position enhances the compound's solubility in organic solvents and can influence its electronic properties. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science, particularly in the development of biologically active molecules. Additionally, the presence of halogen and functional groups suggests that it may participate in nucleophilic substitution and coupling reactions, making it a valuable building block in synthetic chemistry.

Formula: C₆H₇BrN₂O

InChI: InChI=1/C6H7BrN2O/c1-10-5-3-2-4(8)6(7)9-5/h2-3H,8H2,1H3

SMILES: COc1ccc(c(Br)n1)N

Synonyms:

• 2-Bromo-3-Amino-6-Methoxypyridine
• 2-Bromo-6-Methoxypyridin-3-Amine

3-Amino-2-bromo-6-methoxypyridine

CAS: 135795-46-9

Formula: C₆H₇BrN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 203.0366

Ref: IN-DA003IUD

2-Bromo-6-methoxypyridin-3-amine

CAS: 135795-46-9

2-Bromo-6-methoxypyridin-3-amine

Purity: 98%

Color and Shape: Solid

Molecular weight: 203.04g/mol

Ref: 54-OR315074

3-Amino-2-bromo-6-methoxypyridine

CAS: 135795-46-9

Formula: C₆H₇BrN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 203.039

Ref: 10-F219442

2-Bromo-6-methoxypyridin-3-amine

CAS: 135795-46-9

2-Bromo-6-methoxypyridin-3-amine is a perovskite that has been shown to have a high photoluminescence quantum yield and can be used in solar cells. This compound interacts with both the ligands and the acceptors, boosting the efficiency of these compounds. The 2-bromo-6 methoxypyridin-3 amine is a semiconductor with an electron affinity of 1.9 eV and a band gap of 1.6 eV. It has been shown to be efficient as a photoluminescent material in nanocrystals.

Formula: C₆H₇BrN₂O

Purity: Min. 95%

Molecular weight: 203.04 g/mol

Ref: 3D-FB140331