CAS 13580-86-4

4-CHLORO-PHTHALAZIN-1-YLAMINE

Description:

4-Chloro-phthalazin-1-ylamine is an organic compound characterized by its phthalazine core, which is a bicyclic structure containing two fused aromatic rings. The presence of a chloro group at the 4-position and an amino group at the 1-position contributes to its reactivity and potential applications in various chemical reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. Its chemical structure suggests potential uses in the synthesis of dyes, pharmaceuticals, or agrochemicals, as compounds with similar frameworks often exhibit biological activity. Additionally, the presence of the chlorine atom may influence its electronic properties and reactivity, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-chloro-phthalazin-1-ylamine is a noteworthy compound in the field of organic chemistry with diverse potential applications.

Formula: C₈H₆ClN₃

InChI: InChI=1/C8H6ClN3/c9-7-5-3-1-2-4-6(5)8(10)12-11-7/h1-4H,(H2,10,12)

SMILES: c1ccc2c(c1)c(Cl)n[nH]c2=N

Synonyms:

• Aurora Ka-269
• 4-Chlorophthalazin-1-Amine
• 4-chloro-1-Phthalazinamine
• 4-CHLORO-PHTHALAZIN-1-YLAMINE
• 1-Phthalazinamine,4-chloro-

1-Phthalazinamine,4-chloro-

CAS: 13580-86-4

Formula: C₈H₆ClN₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 179.6063

Ref: IN-DA007N65

4-chlorophthalazin-1-amine

CAS: 13580-86-4

4-chlorophthalazin-1-amine

Purity: 98%

Molecular weight: 179.61g/mol

Ref: 54-OR1035943

4-CHLOROPHTHALAZIN-1-AMINE

CAS: 13580-86-4

Purity: 98%

Molecular weight: 179.6100006

Ref: 10-F846357

4-Chlorophthalazin-1-amine

CAS: 13580-86-4

4-Chlorophthalazin-1-amine is a tetracyclic compound that is synthesized by the sequential use of alkylation, transition, and alkylation reactions. The first step of the synthesis involves the reaction of an aryl glyoxal with a pyridazine to give an intermediate which undergoes intramolecular cyclization to form a pyridazine. The second step involves the reaction of this intermediate with phenyl bromide to form the desired product. 4-Chlorophthalazin-1-amine is used as a catalyst in amination reactions.

Formula: C₈H₆ClN₃

Purity: Min. 95%

Molecular weight: 179.6 g/mol

Ref: 3D-NAA58086