CAS 135808-66-1

3,5-Dimethoxybenzylmagnesium chloride solution

Description:

3,5-Dimethoxybenzylmagnesium chloride is a Grignard reagent, which is a type of organomagnesium compound used extensively in organic synthesis. This compound features a benzyl group substituted with two methoxy groups at the 3 and 5 positions, enhancing its reactivity and solubility in organic solvents. As a Grignard reagent, it is highly reactive, particularly with electrophiles, and can participate in nucleophilic addition reactions, making it valuable for forming carbon-carbon bonds. The presence of the methoxy groups can also influence the electronic properties of the molecule, potentially increasing its nucleophilicity. In solution, it is typically handled under an inert atmosphere to prevent reaction with moisture or carbon dioxide, which can lead to the formation of unwanted byproducts. Safety precautions are essential when working with this compound, as Grignard reagents can be flammable and react violently with water. Overall, 3,5-Dimethoxybenzylmagnesium chloride is a versatile reagent in synthetic organic chemistry, particularly in the construction of complex molecular architectures.

Formula: C₉H₁₁ClMgO₂

InChI: InChI=1/C9H11O2.ClH.Mg/c1-7-4-8(10-2)6-9(5-7)11-3;;/h4-6H,1H2,2-3H3;1H;/q;;+1/p-1/rC9H11ClMgO2/c1-12-8-3-7(6-11-10)4-9(5-8)13-2/h3-5H,6H2,1-2H3

SMILES: C=C1C=C([CH]C(=C1)OC)OC.Cl.[Mg]

Synonyms:

• Chloro-[(3,5-Dimethoxyphenyl)Methyl]Magnesium