CAS 13582-96-2

10H-Phenothiazine-10-ethanamine, N,N,α-trimethyl-, 5,5-dioxide, (-)-

Description:

10H-Phenothiazine-10-ethanamine, N,N,α-trimethyl-, 5,5-dioxide, commonly referred to as a derivative of phenothiazine, is a chemical compound characterized by its complex structure that includes a phenothiazine core with additional functional groups. This compound typically exhibits properties associated with phenothiazines, such as being a heterocyclic aromatic compound. It is known for its potential pharmacological applications, particularly in the field of psychiatry, where phenothiazine derivatives are used as antipsychotic medications. The presence of the N,N,α-trimethyl group enhances its lipophilicity, which can influence its bioavailability and interaction with biological systems. The 5,5-dioxide moiety indicates the presence of sulfone groups, which can affect the compound's reactivity and stability. Additionally, the stereochemistry denoted by "(-)" suggests that the compound has a specific chiral configuration, which may play a crucial role in its biological activity and therapeutic effects. Overall, this compound represents a significant class of pharmaceuticals with diverse applications in medicine.

Formula: C₁₇H₂₀N₂O₂S

InChI: InChI=1/C17H20N2O2S/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)22(20,21)17-11-7-5-9-15(17)19/h4-11,13H,12H2,1-3H3

InChI key: InChIKey=FDXKCOBAFGSMDJ-UHFFFAOYNA-N

SMILES: C(C(N(C)C)C)N1C=2C(S(=O)(=O)C=3C1=CC=CC3)=CC=CC2

Synonyms:

• (-)-Dioxopromethazine
• Phenothiazine, 10-[2-(dimethylamino)propyl]-, 5,5-dioxide, (-)-
• 10H-Phenothiazine-10-ethanamine, N,N,α-trimethyl-, 5,5-dioxide, (-)-

10H-Phenothiazine-10-ethanamine, N,N,α-trimethyl-, 5,5-dioxide, (-)-

CAS: 13582-96-2

Formula: C₁₇H₂₀N₂O₂S

Molecular weight: 316.4179

Ref: IN-DA01X5EV