
CAS 135832-53-0
:5-Chloro-2-fluorobenzenepropanol
Description:
5-Chloro-2-fluorobenzenepropanol is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both chlorine and fluorine atoms, as well as a propanol group. The presence of the chlorine and fluorine substituents contributes to its unique chemical properties, including potential reactivity and polarity. This compound is likely to exhibit moderate solubility in polar solvents due to the hydroxyl (-OH) group, while the halogen substituents may influence its reactivity in nucleophilic substitution reactions. The specific arrangement of the substituents on the benzene ring can affect its steric and electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the compound's CAS number, 135832-53-0, allows for easy identification in chemical databases, facilitating research and development efforts. Safety and handling precautions should be observed, as halogenated compounds can pose health and environmental risks.
Formula:C9H10ClFO
InChI:InChI=1S/C9H10ClFO/c10-8-3-4-9(11)7(6-8)2-1-5-12/h3-4,6,12H,1-2,5H2
InChI key:InChIKey=KXQLTZINLFWGPH-UHFFFAOYSA-N
SMILES:C(CCO)C1=C(F)C=CC(Cl)=C1
Synonyms:- 3-(5-Chloro-2-fluorophenyl)-1-propanol
- 5-Chloro-2-fluorobenzenepropanol
- Benzenepropanol, 5-chloro-2-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.