CAS 135855-62-8

1H-Indol-6-amine,1-methyl-(9CI)

Description:

1H-Indol-6-amine, 1-methyl- (9CI), with the CAS number 135855-62-8, is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features an amino group (-NH2) at the 6-position and a methyl group (-CH3) at the 1-position of the indole ring. It is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents, depending on the specific functional groups present. The presence of the amino group suggests potential basicity and reactivity in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, compounds of this type may have biological significance, as indole derivatives are often studied for their roles in pharmaceuticals and as intermediates in the synthesis of various bioactive molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₉H₁₀N₂

InChI: InChI=1/C9H10N2/c1-11-5-4-7-2-3-8(10)6-9(7)11/h2-6H,10H2,1H3

SMILES: Cn1ccc2ccc(cc12)N

Synonyms:

• 1H-Indol-6-amine, 1-methyl-
• 1-Methyl-1H-indol-6-amine

1-Methyl-1H-indol-6-amine

CAS: 135855-62-8

Formula: C₉H₁₀N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 146.1891

Ref: IN-DA003N24

1-Methyl-1H-indol-6-amine

CAS: 135855-62-8

1-Methyl-1H-indol-6-amine

Purity: 96%

Molecular weight: 146.19g/mol

Ref: 54-OR953134

1-Methyl-1H-indol-6-amine

CAS: 135855-62-8

Formula: C₉H₁₀N₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 146.193

Ref: 10-F231082

1-Methyl-1H-indol-6-amine

CAS: 135855-62-8

Versatile small molecule scaffold

Formula: C₉H₁₀N₂

Purity: Min. 95%

Molecular weight: 146.19 g/mol

Ref: 3D-KFA85562