CAS 135857-20-4

2-(4-formylphenoxy)acetamide

Description:

2-(4-formylphenoxy)acetamide, with the CAS number 135857-20-4, is an organic compound characterized by its amide functional group and a phenoxy moiety. This compound features a formyl group (-CHO) attached to a phenyl ring, which is further connected to an acetamide group (-C(=O)NH2). The presence of the formyl group suggests that it can participate in various chemical reactions, such as condensation or reduction, making it a versatile intermediate in organic synthesis. The phenoxy group contributes to the compound's potential solubility in organic solvents and may influence its reactivity and interaction with biological systems. Additionally, the amide bond indicates that the compound may exhibit hydrogen bonding capabilities, which can affect its physical properties, such as melting point and boiling point. Overall, 2-(4-formylphenoxy)acetamide is of interest in medicinal chemistry and materials science due to its structural features and potential applications in drug development and synthesis.

Formula: C₉H₉NO₃

InChI: InChI=1/C9H9NO3/c10-9(12)6-13-8-3-1-7(5-11)2-4-8/h1-5H,6H2,(H2,10,12)

SMILES: c1cc(ccc1C=O)OCC(=N)O

Synonyms:

• Acetamide, 2-(4-formylphenoxy)-

2-(4-Formylphenoxy)acetamide

CAS: 135857-20-4

Formula: C₉H₉NO₃

Color and Shape: Solid

Molecular weight: 179.1727

Ref: IN-DA0080EE

2-(4-Formylphenoxy)acetamide

CAS: 135857-20-4

Formula: C₉H₉NO₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 179.175

Ref: 10-F014195