CAS 135865-78-0
:(S)-tert-Butyl 3-oxo-1-phenylpropylcarbamate
Description:
(S)-tert-Butyl 3-oxo-1-phenylpropylcarbamate, identified by its CAS number 135865-78-0, is a chemical compound characterized by its specific stereochemistry and functional groups. It features a tert-butyl group, which contributes to its hydrophobic properties, and a carbamate functional group, which is known for its ability to form hydrogen bonds and participate in various chemical reactions. The presence of the phenyl group indicates potential aromatic characteristics, which can influence the compound's reactivity and solubility. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its stereochemistry, denoted by the (S) configuration, suggests that it may exhibit specific biological activity or selectivity in reactions. Overall, the combination of these structural features makes (S)-tert-Butyl 3-oxo-1-phenylpropylcarbamate a compound of interest in both synthetic and medicinal chemistry.
Formula:C14H19NO3
InChI:InChI=1/C14H19NO3/c1-14(2,3)18-13(17)15-12(9-10-16)11-7-5-4-6-8-11/h4-8,10,12H,9H2,1-3H3,(H,15,17)/t12-/m0/s1
SMILES:CC(C)(C)OC(=N[C@@H](CC=O)c1ccccc1)O
Synonyms:- tert-butyl [(1S)-3-oxo-1-phenylpropyl]carbamate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Boc-(S)-3-Amino-3-phenylpropanal
CAS:Formula:C14H19NO3Purity:95%Color and Shape:SolidMolecular weight:249.3056Boc-(S)-3-Amino-3-phenylpropanal
CAS:Boc-(S)-3-Amino-3-phenylpropanalPurity:95%Molecular weight:249.31g/molBoc-(S)-3-Amino-3-phenylpropanal
CAS:Formula:C14H19NO3Purity:95%Color and Shape:SolidMolecular weight:249.31N-Boc-(3S)-3-phenyl-3-aminopropionaldehyde
CAS:Controlled ProductFormula:C14H19NO3Color and Shape:NeatMolecular weight:249.31N-Boc-(3S)-3-phenyl-3-aminopropionaldehyde
CAS:N-Boc-(3S)-3-phenyl-3-aminopropionaldehyde is a synthetic chiral ligand that can be used as a building block in the synthesis of other compounds. It has been used to optimize the synthetic process, and it can be used in buffers, ammonium formate, metal chelate, and other additives to synthesize new compounds. N-Boc-(3S)-3-phenyl-3-aminopropionaldehyde is an optical isomer that can be used for supercritical fluid chromatography (SCFC) or liquid chromatography (LC). This compound has been shown to have a high affinity for ligands with a phenol group.Formula:C14H19NO3Purity:Min. 95%Molecular weight:249.31 g/mol





