CymitQuimica logo

CAS 135875-11-5

:

8-Chloro-2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,7-a]benzimidazole

Description:
8-Chloro-2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,7-a]benzimidazole is a chemical compound characterized by its complex bicyclic structure, which incorporates both diazepine and benzimidazole moieties. This compound features a chlorine atom at the 8-position, contributing to its unique reactivity and potential biological activity. The tetrahydro configuration indicates the presence of saturated rings, which can influence its pharmacokinetic properties. Typically, compounds of this nature are investigated for their potential therapeutic applications, particularly in the fields of neuroscience and pharmacology, due to their ability to interact with neurotransmitter systems. The presence of the diazepine structure suggests possible anxiolytic or sedative effects, while the benzimidazole component may enhance its binding affinity to specific receptors. Additionally, the compound's solubility, stability, and reactivity can be influenced by its functional groups and overall molecular geometry. As with many synthetic organic compounds, understanding its characteristics is crucial for assessing its potential uses in medicinal chemistry and drug development.
Formula:C11H12ClN3
InChI:InChI=1S/C11H12ClN3/c12-8-1-2-10-9(7-8)14-11-3-4-13-5-6-15(10)11/h1-2,7,13H,3-6H2
InChI key:InChIKey=TUQCFGVWQPJWRV-UHFFFAOYSA-N
SMILES:ClC=1C=C2C(N3C(=N2)CCNCC3)=CC1
Synonyms:
  • 1H-[1,4]Diazepino[1,7-a]benzimidazole, 8-chloro-2,3,4,5-tetrahydro-
  • 8-Chloro-2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,7-a]benzimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.