CymitQuimica logo

CAS 135876-30-1

:

1,3-Isobenzofurandione, 5,5'-(9H-fluoren-9-ylidene)bis-

Description:
1,3-Isobenzofurandione, 5,5'-(9H-fluoren-9-ylidene)bis- is a synthetic organic compound characterized by its unique structure, which includes a fused isobenzofuran dione moiety and a fluorenylidene group. This compound typically exhibits properties associated with conjugated systems, such as enhanced stability and potential for electronic delocalization, which can influence its reactivity and interaction with other molecules. It may display fluorescence due to its aromatic components, making it of interest in materials science and organic electronics. The presence of the isobenzofurandione unit suggests potential applications in dye chemistry or as a precursor for further chemical modifications. Additionally, the compound's structure may impart specific solubility characteristics, affecting its behavior in various solvents. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as temperature and pH. Safety data and handling precautions should be considered, as with any chemical substance, to ensure safe laboratory practices.
Formula:C29H14O6
InChI:InChI=1S/C29H14O6/c30-25-19-11-9-15(13-21(19)27(32)34-25)29(16-10-12-20-22(14-16)28(33)35-26(20)31)23-7-3-1-5-17(23)18-6-2-4-8-24(18)29/h1-14H
InChI key:FMACFWAQBPYRFO-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C3=CC=CC=C3C2(C4=CC5=C(C=C4)C(=O)OC5=O)C6=CC7=C(C=C6)C(=O)OC7=O
Found 4 products.