CAS 13589-71-4

2-hydroxy-3-methylbenzonitrile

Description:

2-Hydroxy-3-methylbenzonitrile, with the CAS number 13589-71-4, is an organic compound characterized by the presence of a hydroxyl group (-OH) and a nitrile group (-C≡N) attached to a benzene ring. This compound features a methyl group (-CH₃) at the meta position relative to the hydroxyl group, contributing to its structural diversity. It is typically a white to off-white solid at room temperature and is soluble in polar organic solvents. The presence of both the hydroxyl and nitrile functional groups imparts unique chemical reactivity, making it useful in various synthetic applications, including pharmaceuticals and agrochemicals. The compound can participate in hydrogen bonding due to the hydroxyl group, influencing its physical properties such as boiling and melting points. Additionally, its aromatic structure provides stability and can engage in electrophilic substitution reactions. Overall, 2-hydroxy-3-methylbenzonitrile is a versatile compound with significant implications in organic synthesis and material science.

Formula: C₈H₇NO

InChI: InChI=1/C8H7NO/c1-6-3-2-4-7(5-9)8(6)10/h2-4,10H,1H3

SMILES: Cc1cccc(C#N)c1O

2-Hydroxy-3-methylbenzonitrile

CAS: 13589-71-4

Formula: C₈H₇NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 133.1473

Ref: IN-DA0072A9

2-Hydroxy-3-methylbenzonitrile

CAS: 13589-71-4

2-Hydroxy-3-methylbenzonitrile

Purity: 98%

Molecular weight: 133.15g/mol

Ref: 54-OR93715

2-Hydroxy-3-methylbenzonitrile

CAS: 13589-71-4

2-Hydroxy-3-methylbenzonitrile is a high quality chemical that is used as an intermediate in the synthesis of complex compounds. It can be used as a reagent in organic chemistry, and has been shown to be useful for the production of fine chemicals, such as antibiotics. 2-Hydroxy-3-methylbenzonitrile is also a versatile building block for the production of pharmaceuticals and research chemicals. It can be used as a reaction component for the synthesis of speciality chemicals and various building blocks.

Formula: C₈H₇NO

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 133.15 g/mol

Ref: 3D-FH69819

2-Hydroxy-3-methylbenzonitrile

CAS: 13589-71-4

Formula: C₈H₇NO

Purity: 98%

Molecular weight: 133.15

Ref: 10-F460405