CAS 13589-72-5
:5-chloro-2-hydroxybenzonitrile
Description:
5-Chloro-2-hydroxybenzonitrile, with the CAS number 13589-72-5, is an organic compound characterized by the presence of a chloro group, a hydroxyl group, and a nitrile functional group attached to a benzene ring. This compound typically appears as a solid at room temperature and is known for its aromatic properties due to the benzene structure. The chloro substituent introduces a degree of polarity, while the hydroxyl group contributes to its potential for hydrogen bonding, affecting its solubility in various solvents. The nitrile group imparts additional reactivity, making it useful in various chemical syntheses and applications, particularly in pharmaceuticals and agrochemicals. Its molecular structure allows for potential interactions in biological systems, which can be explored for medicinal chemistry purposes. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can exhibit varying degrees of environmental and health impacts. Overall, 5-chloro-2-hydroxybenzonitrile is a versatile compound with significant relevance in organic synthesis and material science.
Formula:C7H4ClNO
InChI:InChI=1/C7H4ClNO/c8-6-1-2-7(10)5(3-6)4-9/h1-3,10H
SMILES:c1cc(c(cc1Cl)C#N)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Chloro-2-hydroxybenzonitrile
CAS:Formula:C7H4ClNOPurity:97%Color and Shape:SolidMolecular weight:153.56585-Chloro-2-hydroxybenzonitrile
CAS:5-Chloro-2-hydroxybenzonitrileFormula:C7H4ClNOPurity:95%Color and Shape: off-white solidMolecular weight:153.57g/mol5-Chloro-2-hydroxybenzonitrile
CAS:5-Chloro-2-hydroxybenzonitrile is a liquid crystal compound that is used for the enhancement of phototransformation. It has been shown to be capable of absorbing light and transferring energy to electron acceptors, such as chloride ions, which react with the excited state. 5-Chloro-2-hydroxybenzonitrile shows a single band in the visible region on an absorption spectrum, which may be due to its molecular structure or anisotropy. The frequency of this compound's vibration is in the range of 3200 - 3600 cm^{-1}.
Formula:C7H4ClNOPurity:Min. 95%Color and Shape:PowderMolecular weight:153.57 g/mol5-Chloro-2-hydroxy-benzonitrile
CAS:Formula:C7H4ClNOPurity:97%Color and Shape:Solid, PowderMolecular weight:153.57



