CAS 135908-45-1
:Bicyclo[2.2.2]octane-1-carboxylic acid, 4-amino-, ethyl ester
Description:
Bicyclo[2.2.2]octane-1-carboxylic acid, 4-amino-, ethyl ester, identified by CAS number 135908-45-1, is a bicyclic compound characterized by its unique bicyclo[2.2.2]octane framework, which consists of a fused ring system that imparts rigidity and stability to the molecule. The presence of a carboxylic acid functional group and an amino group suggests that this compound can participate in various chemical reactions, including esterification and amination. The ethyl ester moiety indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid. This compound may exhibit interesting biological activities due to the presence of the amino group, which can facilitate interactions with biological targets. Additionally, the bicyclic structure may influence its physical properties, such as solubility and melting point. Overall, Bicyclo[2.2.2]octane-1-carboxylic acid, 4-amino-, ethyl ester is a compound of interest in both synthetic organic chemistry and potential pharmaceutical applications, although specific biological or pharmacological data would require further investigation.
Formula:C11H19NO2
InChI:InChI=1S/C11H19NO2/c1-2-14-9(13)10-3-6-11(12,7-4-10)8-5-10/h2-8,12H2,1H3
InChI key:InChIKey=QUVAHJOADQNEIP-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C12CCC(N)(CC1)CC2
Synonyms:- Bicyclo[2.2.2]octane-1-carboxylic acid, 4-amino-, ethyl ester
- Ethyl 4-aminobicyclo[2.2.2]octane-1-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ethyl 4-aminobicyclo[2.2.2]octane-1-carboxylate
CAS:<p>Ethyl 4-aminobicyclo[2.2.2]octane-1-carboxylate</p>Molecular weight:197.27g/mol

