CAS 135937-96-1
:2-ACETYLTHIOISOBUTYRIC ACID
Description:
2-Acetylthioisobutyric acid, identified by its CAS number 135937-96-1, is an organic compound characterized by the presence of both an acetyl group and a thiol functional group attached to an isobutyric acid backbone. This compound typically exhibits properties associated with carboxylic acids, including the ability to form hydrogen bonds and participate in acid-base reactions. Its structure suggests potential reactivity due to the presence of the thiol group, which can engage in nucleophilic reactions and form disulfide bonds. The compound may also display moderate solubility in polar solvents, influenced by the carboxylic acid moiety. Additionally, 2-acetylthioisobutyric acid may have applications in organic synthesis and as an intermediate in the production of various chemical products. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C6H10O2S
InChI:InChI=1/C6H10O2S/c1-4(7)6(2,3)5(8)9/h1-3H3,(H,8,9)
SMILES:CC(=O)C(C)(C)C(=O)S
Synonyms:- (2-Acetylthio)-2-Methylpropanoic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Acetylthioisobutyric Acid
CAS:Controlled Product<p>Applications 2-Acetylthioisobutyric Acid (cas# 135937-96-1) is a compound useful in organic synthesis.<br>References Souers, A., et al.: Bioorg. Med. Chem. Lett., 8, 2297 (1998), Deaton, D., et al.: Bioorg. Med. Chem. Lett., 18, 732 (2008),<br></p>Formula:C6H10O3SColor and Shape:NeatMolecular weight:162.21
