CAS 135944-08-0: N-FMOC-D,L-2-AMINOTETRALIN-2-CARBOXYLIC ACID
Description:N-FMOC-D,L-2-Aminotetralin-2-carboxylic acid is a chemical compound characterized by its structure, which includes a tetralin core substituted with an amino group and a carboxylic acid functional group. The "N-FMOC" designation indicates the presence of a 9-fluorenylmethoxycarbonyl (FMOC) protecting group on the nitrogen atom of the amino group, which is commonly used in peptide synthesis to protect amines during chemical reactions. This compound is typically utilized in the field of medicinal chemistry and peptide synthesis, serving as an intermediate or building block for the development of bioactive molecules. Its properties include solubility in organic solvents, and it may exhibit specific reactivity patterns due to the functional groups present. The compound's stereochemistry, being D,L, suggests the presence of both enantiomers, which can influence its biological activity. Overall, N-FMOC-D,L-2-aminotetralin-2-carboxylic acid is a valuable compound in synthetic organic chemistry, particularly in the context of drug development and peptide research.
Formula:C26H23NO4
InChI:InChI=1/C26H23NO4/c28-24(29)26(14-13-17-7-1-2-8-18(17)15-26)27-25(30)31-16-23-21-11-5-3-9-19(21)20-10-4-6-12-22(20)23/h1-12,23H,13-16H2,(H,27,30)(H,28,29)
- Synonyms:
- Fmoc-Atc
- Fmoc-Atc-Oh
- Fmoc-(D,L)-2-Aminotetraline-2-Carboxylic Acid
- 2-(9H-Fluoren-9-Ylmethoxycarbonylamino)-1,2,3,4-Tetrahydro-Naphthalene-2-Carboxylic Acid
- 2-N-Fmoc-Amino-Tetrahydro-2-Naphthoic Acid
- Rarechem Em Wb 0072
- (R,S)-Fmoc-2-Aminotetraline-2-Carboxylic Acid
- 2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid REF: 54-OR80866CAS: 135944-08-0 | 95% | 616.00 €~1,942.00 € | Mon 31 Mar 25 |
![]() | Fmoc-2-Aminotetralin-2-carboxylic acid REF: 10-F046677CAS: 135944-08-0 | 95.0% | To inquire | Mon 07 Apr 25 |
![]() | Fmoc-(DL)-2-aminotetraline-2-carboxylic acid REF: 3D-FF55963CAS: 135944-08-0 | Min. 95% | - - - | Discontinued product |

2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid
Ref: 54-OR80866
1g | 616.00 € | ||
5g | 1,942.00 € |

Fmoc-2-Aminotetralin-2-carboxylic acid
Ref: 10-F046677
1g | To inquire |

Fmoc-(DL)-2-aminotetraline-2-carboxylic acid
Ref: 3D-FF55963
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |