CAS 1359655-70-1

3-Fluoro-N,N-dimethyl-4-(2-pyrrolidinyl)benzenamine

Description:

3-Fluoro-N,N-dimethyl-4-(2-pyrrolidinyl)benzenamine is an organic compound characterized by its aromatic amine structure, which includes a fluorine substituent at the meta position relative to the amine group. The presence of the dimethylamino group enhances its basicity and solubility in polar solvents, while the pyrrolidine ring contributes to its potential biological activity and lipophilicity. This compound may exhibit interesting pharmacological properties due to the combination of the aromatic system and the nitrogen-containing heterocycle. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders. The fluorine atom can influence the compound's electronic properties, potentially enhancing its binding affinity to biological targets. Additionally, the compound's stability and reactivity can be influenced by the presence of the fluorine and the dimethylamino group, making it a subject of interest in synthetic organic chemistry and drug design. As with many such compounds, safety and handling precautions should be observed due to potential toxicity and reactivity.

Formula: C₁₂H₁₇FN₂

InChI: InChI=1S/C12H17FN2/c1-15(2)9-5-6-10(11(13)8-9)12-4-3-7-14-12/h5-6,8,12,14H,3-4,7H2,1-2H3

InChI key: InChIKey=OSSORCGXDXNTAC-UHFFFAOYSA-N

SMILES: FC1=C(C=CC(N(C)C)=C1)C2CCCN2

Synonyms:

• 3-Fluoro-N,N-dimethyl-4-(2-pyrrolidinyl)benzenamine
• Benzenamine, 3-fluoro-N,N-dimethyl-4-(2-pyrrolidinyl)-