CAS 1359656-99-7

3-Azetidinecarboxylic acid, 3-amino-, methyl ester, hydrochloride (1:1)

Description:

3-Azetidinecarboxylic acid, 3-amino-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. This compound features a carboxylic acid functional group and an amino group, contributing to its potential as a building block in pharmaceutical synthesis. The presence of the methyl ester indicates that the carboxylic acid is esterified, which can enhance its lipophilicity and influence its biological activity. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including medicinal chemistry. The compound may exhibit properties such as being a potential intermediate in the synthesis of more complex molecules or serving as a ligand in coordination chemistry. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular structure. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₅H₁₀N₂O₂·ClH

InChI: InChI=1S/C5H10N2O2.ClH/c1-9-4(8)5(6)2-7-3-5;/h7H,2-3,6H2,1H3;1H

InChI key: InChIKey=BPHXTNUWBLFKHQ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1(N)CNC1.Cl

Synonyms:

• 3-Azetidinecarboxylic acid, 3-amino-, methyl ester, hydrochloride (1:1)