
CAS 1359658-40-4
:(2R)-2-(Bromomethyl)-4-(phenylmethyl)morpholine
Description:
(2R)-2-(Bromomethyl)-4-(phenylmethyl)morpholine is a chemical compound characterized by its morpholine structure, which is a six-membered ring containing both nitrogen and oxygen atoms. The presence of a bromomethyl group at the 2-position and a phenylmethyl group at the 4-position contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The compound is likely to exhibit properties typical of morpholines, such as being a polar, heterocyclic amine, which can participate in various chemical reactions, including nucleophilic substitutions and cyclizations. Its stereochemistry, indicated by the (2R) designation, suggests that it has specific spatial arrangements that may influence its biological activity and interactions with other molecules. Additionally, the bromine atom can serve as a leaving group in reactions, making this compound a valuable intermediate in the synthesis of more complex organic molecules. Overall, its structural features and functional groups suggest potential utility in pharmaceutical development and chemical research.
Formula:C12H16BrNO
InChI:InChI=1S/C12H16BrNO/c13-8-12-10-14(6-7-15-12)9-11-4-2-1-3-5-11/h1-5,12H,6-10H2/t12-/m0/s1
InChI key:InChIKey=HYDNAFJDFGPLGH-LBPRGKRZSA-N
SMILES:C(N1C[C@H](CBr)OCC1)C2=CC=CC=C2
Synonyms:- Morpholine, 2-(bromomethyl)-4-(phenylmethyl)-, (2R)-
- (2R)-2-(Bromomethyl)-4-(phenylmethyl)morpholine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.