CAS 13597-87-0: trisilane, 2-silyl-

Description:Trisilane, 2-silyl- is a chemical compound characterized by its silicon-based structure, specifically containing three silicon atoms in its backbone. It is part of the silane family, which are compounds composed of silicon and hydrogen. The presence of silyl groups indicates that it has substituents attached to the silicon atoms, which can influence its reactivity and properties. Trisilane compounds are generally known for their volatility and can be used in various applications, including as precursors in the synthesis of silicon-based materials and in the semiconductor industry. They may exhibit unique properties such as low viscosity and the ability to form siloxane bonds upon hydrolysis. Additionally, trisilane compounds can participate in reactions typical of organosilicon chemistry, including hydrosilylation and polymerization. Safety considerations are important when handling such substances, as they can be flammable and may pose health risks if inhaled or ingested. Overall, trisilane, 2-silyl- represents a versatile class of compounds with significant industrial relevance.

Formula:H₁₀Si₄

InChI:InChI=1/H10Si4/c1-4(2)3/h4H,1-3H3