CAS 1359703-30-2

4-Hydrazinyl-α,α-dimethylbenzeneacetonitrile

Description:

4-Hydrazinyl-α,α-dimethylbenzeneacetonitrile, identified by its CAS number 1359703-30-2, is an organic compound characterized by the presence of a hydrazine functional group attached to a dimethyl-substituted benzene ring, along with an acetonitrile moiety. This compound typically exhibits properties associated with both hydrazines and nitriles, including potential reactivity due to the hydrazine group, which can participate in various chemical reactions such as condensation and oxidation. The dimethyl substitution on the benzene ring can influence its steric and electronic properties, potentially affecting its reactivity and solubility in different solvents. Additionally, compounds of this nature may have applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, specific safety and handling guidelines should be followed due to the potential toxicity associated with hydrazine derivatives. As with any chemical substance, understanding its characteristics, including stability, reactivity, and potential hazards, is crucial for safe and effective use in laboratory or industrial settings.

Formula: C₁₀H₁₃N₃

InChI: InChI=1S/C10H13N3/c1-10(2,7-11)8-3-5-9(13-12)6-4-8/h3-6,13H,12H2,1-2H3

InChI key: InChIKey=ISLYNKMGKQCEKE-UHFFFAOYSA-N

SMILES: C(C#N)(C)(C)C1=CC=C(NN)C=C1

Synonyms:

• 4-Hydrazinyl-α,α-dimethylbenzeneacetonitrile
• 2-(4-Hydrazinylphenyl)-2-methylpropanenitrile
• Benzeneacetonitrile, 4-hydrazinyl-α,α-dimethyl-